ChemNet > CAS > 52727-57-8 Methyl 2-amino-5-bromobenzoate
52727-57-8 Methyl 2-amino-5-bromobenzoate
| product Name |
Methyl 2-amino-5-bromobenzoate |
| Synonyms |
2-Amino-5-bromobenzoic acid methyl ester; 5-Bromoanthranilic acid methyl ester |
| Molecular Formula |
C8H8BrNO2 |
| Molecular Weight |
230.0586 |
| InChI |
InChI=1/C8H8BrNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
| CAS Registry Number |
52727-57-8 |
| Molecular Structure |
|
| Density |
1.578g/cm3 |
| Melting point |
72-74℃ |
| Boiling point |
286.3°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
126.9°C |
| Vapour Pressur |
0.00266mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
