ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
| product Name |
thianaphthene-3-carboxaldehyde |
| Synonyms |
1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
| Molecular Formula |
C9H6OS |
| Molecular Weight |
162.2083 |
| InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
| CAS Registry Number |
5381-20-4 |
| Molecular Structure |
|
| Density |
1.3g/cm3 |
| Melting point |
56-58℃ |
| Boiling point |
303.2°C at 760 mmHg |
| Refractive index |
1.719 |
| Flash point |
137.2°C |
| Vapour Pressur |
0.000944mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
