ChemNet > CAS > 5392-12-1 2-Methoxy-1-naphthaldehyde
5392-12-1 2-Methoxy-1-naphthaldehyde
product Name |
2-Methoxy-1-naphthaldehyde |
Synonyms |
2-Methoxy-1-naphthylaldehyde; NSC 28471; NSC 3256; 2-methoxynaphthalene-1-carbaldehyde |
Molecular Formula |
C12H10O2 |
Molecular Weight |
186.2066 |
InChI |
InChI=1/C12H10O2/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-8H,1H3 |
CAS Registry Number |
5392-12-1 |
EINECS |
226-392-5 |
Molecular Structure |
|
Density |
1.169g/cm3 |
Melting point |
81-84℃ |
Boiling point |
339.1°C at 760 mmHg |
Refractive index |
1.642 |
Flash point |
167.4°C |
Vapour Pressur |
9.39E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|