ChemNet > CAS > 5411-58-5 Ethyl NN-Diethyloxamate
5411-58-5 Ethyl NN-Diethyloxamate
| product Name |
Ethyl NN-Diethyloxamate |
| Synonyms |
5411-58-5; Ethyl (diethylamino)(oxo)acetate; Ethyl diethyl oxamate; ETHYL N,N-DIETHYLOXAMATE; Ethyl NN-Diethyloxamate |
| Molecular Formula |
C8H15NO3 |
| Molecular Weight |
173.2096 |
| InChI |
InChI=1/C8H15NO3/c1-4-9(5-2)7(10)8(11)12-6-3/h4-6H2,1-3H3 |
| CAS Registry Number |
5411-58-5 |
| Molecular Structure |
|
| Density |
1.028g/cm3 |
| Boiling point |
218.7°C at 760 mmHg |
| Refractive index |
1.442 |
| Flash point |
86°C |
| Vapour Pressur |
0.124mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
