ChemNet > CAS > 543-20-4 Succinyl chloride
543-20-4 Succinyl chloride
| product Name |
Succinyl chloride |
| Synonyms |
Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
| Molecular Formula |
C4H4Cl2O2 |
| Molecular Weight |
154.9794 |
| InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
| CAS Registry Number |
543-20-4 |
| EINECS |
208-838-0 |
| Molecular Structure |
|
| Density |
1.389g/cm3 |
| Melting point |
16-17℃ |
| Boiling point |
193.4°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
76.7°C |
| Vapour Pressur |
0.466mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
