ChemNet > CAS > 5469-19-2 5-Bromo-1,2,4-trimethylbenzene
5469-19-2 5-Bromo-1,2,4-trimethylbenzene
product Name |
5-Bromo-1,2,4-trimethylbenzene |
Synonyms |
5-Bromopseudocumene; 1-bromo-2,4,5-trimethylbenzene |
Molecular Formula |
C9H11Br |
Molecular Weight |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-6-4-8(3)9(10)5-7(6)2/h4-5H,1-3H3 |
CAS Registry Number |
5469-19-2 |
EINECS |
226-793-5 |
Molecular Structure |
|
Density |
1.289g/cm3 |
Melting point |
70-73℃ |
Boiling point |
234.2°C at 760 mmHg |
Refractive index |
1.539 |
Flash point |
96.7°C |
Vapour Pressur |
0.0818mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|