ChemNet > CAS > 551-72-4 L-chiro-Inositol
551-72-4 L-chiro-Inositol
| product Name |
L-chiro-Inositol |
| Synonyms |
1L-chiro-inositol; (1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol |
| Molecular Formula |
C6H12O6 |
| Molecular Weight |
180.1559 |
| InChI |
InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m1/s1 |
| CAS Registry Number |
551-72-4 |
| EINECS |
209-000-7 |
| Molecular Structure |
|
| Density |
2.039g/cm3 |
| Melting point |
230℃ |
| Boiling point |
291.326°C at 760 mmHg |
| Refractive index |
1.784 |
| Flash point |
143.387°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
