ChemNet > CAS > 5519-23-3 4-n-Decyloxybenzoic acid
5519-23-3 4-n-Decyloxybenzoic acid
product Name |
4-n-Decyloxybenzoic acid |
Molecular Formula |
C17H26O3 |
Molecular Weight |
278.3865 |
InChI |
InChI=1/C17H26O3/c1-2-3-4-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19/h10-13H,2-9,14H2,1H3,(H,18,19) |
CAS Registry Number |
5519-23-3 |
Molecular Structure |
|
Density |
1.014g/cm3 |
Melting point |
94-143℃ |
Boiling point |
403.6°C at 760 mmHg |
Refractive index |
1.505 |
Flash point |
138.7°C |
Vapour Pressur |
3.07E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|