ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
| product Name |
bis(2-methoxyphenyl) carbonate |
| Synonyms |
diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
| Molecular Formula |
C15H14O5 |
| Molecular Weight |
274.2687 |
| InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| CAS Registry Number |
553-17-3 |
| EINECS |
209-034-2 |
| Molecular Structure |
|
| Density |
1.208g/cm3 |
| Boiling point |
392.6°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
173.7°C |
| Vapour Pressur |
2.27E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
