ChemNet > CAS > 5720-05-8;917814-66-5 4-Methylbenzeneboronic acid
5720-05-8;917814-66-5 4-Methylbenzeneboronic acid
| product Name |
4-Methylbenzeneboronic acid |
| Synonyms |
AKOS BRN-0019; 4-Tolylboronic Acid; 4-Tolyboronic Acid; 4-Methylphenylboric Acid; 4-Methylphenylboronic Acid; P-Methylphenylboronic Acid; P-Tolylboronic Acid; (4-Methylphenyl)Boronic Acid; (1R)-N-Methyl-1-Phenylethanamine |
| Molecular Formula |
C9H13N |
| Molecular Weight |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/m1/s1 |
| CAS Registry Number |
5720-05-8;917814-66-5 |
| Molecular Structure |
|
| Density |
0.911g/cm3 |
| Melting point |
256-263℃ |
| Boiling point |
178.7°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
61.6°C |
| Vapour Pressur |
0.976mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
