ChemNet > CAS > 5735-41-1 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester
5735-41-1 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester
product Name |
2-(Hydroxymethyl)benzeneboronic acid cyclic monoester |
Synonyms |
1-Hydroxy-2,1-benzoxaborolane~2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2,1-benzoxaborol-1(3H)-ol; [2-(hydroxymethyl)phenyl]boronic acid |
Molecular Formula |
C7H9BO3 |
Molecular Weight |
151.9556 |
InChI |
InChI=1/C7H9BO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9-11H,5H2 |
CAS Registry Number |
5735-41-1 |
Molecular Structure |
|
Density |
1.25g/cm3 |
Melting point |
95-100℃ |
Boiling point |
379.8°C at 760 mmHg |
Refractive index |
1.566 |
Flash point |
183.5°C |
Vapour Pressur |
1.92E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|