CAS No: 58416-04-9, Chemical Name: 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester
the physical and chemical property of 58416-04-9, 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester is provided by ChemNet.com
ChemNet > CAS > 58416-04-9 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester
58416-04-9 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester
| product Name |
2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester |
| Synonyms |
Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate; 3,4-Dihydroxy-2,5-dicarboxythiophene dimethyl ester; 3,4-Dihydroxy-thiophene-2,5-dicarboxylic acid dimethyl ester; 3,4-Dihydroxythiophene-2,5-dicarboxylic acid diethyl ester; (2E,5E)-2,5-bis[hydroxy(methoxy)methylidene]thiophene-3,4(2H,5H)-dione; 3,4-Dihydroxy-thiophene-2,5-dicarboxylicaciddimethyl ester |
| Molecular Formula |
C8H8O6S |
| Molecular Weight |
232.2105 |
| InChI |
InChI=1/C8H8O6S/c1-13-7(11)5-3(9)4(10)6(15-5)8(12)14-2/h9-10H,1-2H3 |
| CAS Registry Number |
58416-04-9 |
| Molecular Structure |
|
| Density |
1.532g/cm3 |
| Boiling point |
378.558°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
182.745°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
