ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| product Name |
4-(difluoromethoxy)bromobenzene |
| Synonyms |
1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| Molecular Formula |
C7H5BrF2O |
| Molecular Weight |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| CAS Registry Number |
5905-69-1 |
| Molecular Structure |
|
| Density |
1.583g/cm3 |
| Boiling point |
205.406°C at 760 mmHg |
| Refractive index |
1.492 |
| Flash point |
92.591°C |
| Vapour Pressur |
0.359mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
