ChemNet > CAS > 59528-27-7 4-Iodobenzylamine hydrochloride
59528-27-7 4-Iodobenzylamine hydrochloride
| product Name |
4-Iodobenzylamine hydrochloride |
| Synonyms |
1-(4-iodophenyl)methanamine hydrochloride (1:1) |
| Molecular Formula |
C7H9ClIN |
| Molecular Weight |
269.5105 |
| InChI |
InChI=1/C7H8IN.ClH/c8-7-3-1-6(5-9)2-4-7;/h1-4H,5,9H2;1H |
| CAS Registry Number |
59528-27-7 |
| Molecular Structure |
|
| Boiling point |
286.5°C at 760 mmHg |
| Flash point |
127.1°C |
| Vapour Pressur |
0.002mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
