ChemNet > CAS > 606-27-9 Methyl 2-nitrobenzoate
606-27-9 Methyl 2-nitrobenzoate
product Name |
Methyl 2-nitrobenzoate |
Synonyms |
2-Nitrobenzoic acid methyl ester |
Molecular Formula |
C8H7NO4 |
Molecular Weight |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
CAS Registry Number |
606-27-9 |
EINECS |
210-111-8 |
Molecular Structure |
|
Density |
1.301g/cm3 |
Melting point |
-13℃ |
Boiling point |
275°C at 760 mmHg |
Refractive index |
1.553 |
Flash point |
124.8°C |
Vapour Pressur |
0.00523mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|