ChemNet > CAS > 623-37-0 3-Hexanol
623-37-0 3-Hexanol
| product Name |
3-Hexanol |
| Synonyms |
3-Hexyl alcohol; Ethyl propyl carbinol; FEMA No. 3351; NSC 60708; hexan-3-ol; (3S)-hexan-3-ol; (3R)-hexan-3-ol |
| Molecular Formula |
C6H14O |
| Molecular Weight |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| CAS Registry Number |
623-37-0 |
| EINECS |
210-790-0 |
| Molecular Structure |
|
| Density |
0.814g/cm3 |
| Boiling point |
135°C at 760 mmHg |
| Refractive index |
1.413 |
| Flash point |
41.7°C |
| Vapour Pressur |
3.39mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R10:Flammable.;
R22:Harmful if swallowed.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
