ChemNet > CAS > 627-90-7 ethyl undecanoate
627-90-7 ethyl undecanoate
| product Name |
ethyl undecanoate |
| Synonyms |
Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
| Molecular Formula |
C13H26O2 |
| Molecular Weight |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
| CAS Registry Number |
627-90-7 |
| EINECS |
211-018-5 |
| Molecular Structure |
|
| Density |
0.869g/cm3 |
| Melting point |
-15℃ |
| Boiling point |
258.4°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
109.5°C |
| Vapour Pressur |
0.0137mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
