ChemNet > CAS > 6280-80-4 2-Formylphenoxyacetic acid
6280-80-4 2-Formylphenoxyacetic acid
product Name |
2-Formylphenoxyacetic acid |
Molecular Formula |
C9H7O4 |
Molecular Weight |
179.15 |
InChI |
InChI=1/C9H8O4/c10-5-7-3-1-2-4-8(7)13-6-9(11)12/h1-5H,6H2,(H,11,12)/p-1 |
CAS Registry Number |
6280-80-4 |
EINECS |
228-480-9 |
Molecular Structure |
|
Melting point |
129.5-132℃ |
Boiling point |
364°C at 760 mmHg |
Flash point |
151.1°C |
Vapour Pressur |
6.14E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|