ChemNet > CAS > 6738-23-4 2,4-Dimethylanisole
6738-23-4 2,4-Dimethylanisole
product Name |
2,4-Dimethylanisole |
Synonyms |
1,3-Dimethyl-4-methoxybenzene; 4-Methoxy-m-xylene |
Molecular Formula |
C9H12O |
Molecular Weight |
136.19 |
InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)8(2)6-7/h4-6H,1-3H3 |
CAS Registry Number |
6738-23-4 |
EINECS |
229-794-9 |
Molecular Structure |
|
Density |
0.97 |
Boiling point |
191℃ |
Refractive index |
1.513-1.515 |
Flash point |
63℃ |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|