ChemNet > CAS > 68837-59-2 4-Bromo-2-methylbenzoic acid
68837-59-2 4-Bromo-2-methylbenzoic acid
| product Name |
4-Bromo-2-methylbenzoic acid |
| Synonyms |
2-Methyl-4-Bromobenzoic acid; RARECHEM AL BO 0455; 4-Bromo-o-toluic acid |
| Molecular Formula |
C8H7BrO2 |
| Molecular Weight |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS Registry Number |
68837-59-2 |
| EINECS |
272-437-7 |
| Molecular Structure |
|
| Density |
1.599g/cm3 |
| Melting point |
180-184℃ |
| Boiling point |
310.1°C at 760 mmHg |
| Refractive index |
1.595 |
| Flash point |
141.3°C |
| Vapour Pressur |
0.000264mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
