ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
| product Name |
2,4-Dichloro-6-iodoaniline |
| Molecular Formula |
C6H4Cl2IN |
| Molecular Weight |
287.9131 |
| InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| CAS Registry Number |
697-90-5 |
| Molecular Structure |
|
| Density |
2.091g/cm3 |
| Boiling point |
303.8°C at 760 mmHg |
| Refractive index |
1.699 |
| Flash point |
137.5°C |
| Vapour Pressur |
0.000911mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
