ChemNet > CAS > 702-23-8 4-Methoxyphenethyl alcohol
702-23-8 4-Methoxyphenethyl alcohol
| product Name |
4-Methoxyphenethyl alcohol |
| Synonyms |
p-Methoxyphenethyl alcohol; 2-(4-Methoxyphenyl)ethanol; p-Methoxyphenylethanol |
| Molecular Formula |
C9H12O2 |
| Molecular Weight |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
| CAS Registry Number |
702-23-8 |
| EINECS |
211-866-6 |
| Molecular Structure |
|
| Density |
1.058g/cm3 |
| Melting point |
28℃ |
| Boiling point |
257.5°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
110.2°C |
| Vapour Pressur |
0.00745mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
