ChemNet > CAS > 758-12-3 Acetic acid-d
758-12-3 Acetic acid-d
| product Name |
Acetic acid-d |
| Synonyms |
Acetic acid-d1; acetate; (O-~2~H)acetic acid |
| Molecular Formula |
C2H3DO2 |
| Molecular Weight |
61.0581 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
| CAS Registry Number |
758-12-3 |
| EINECS |
212-059-1 |
| Molecular Structure |
|
| Density |
1.086g/cm3 |
| Melting point |
15-16℃ |
| Boiling point |
117.1°C at 760 mmHg |
| Refractive index |
1.375 |
| Flash point |
40°C |
| Vapour Pressur |
13.9mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R35:Causes severe burns.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
