ChemNet > CAS > 7598-91-6 Ethyl 5-hydroxy-2-methylindole-3-carboxylate
7598-91-6 Ethyl 5-hydroxy-2-methylindole-3-carboxylate
product Name |
Ethyl 5-hydroxy-2-methylindole-3-carboxylate |
Synonyms |
5-Hydroxy-2-methyl-3-indolecarboxylic acid ethyl ester; ethyl 5-hydroxy-2-methyl-1H-indole-3-carboxylate |
Molecular Formula |
C12H13NO3 |
Molecular Weight |
219.2365 |
InChI |
InChI=1/C12H13NO3/c1-3-16-12(15)11-7(2)13-10-5-4-8(14)6-9(10)11/h4-6,13-14H,3H2,1-2H3 |
CAS Registry Number |
7598-91-6 |
EINECS |
231-507-7 |
Molecular Structure |
|
Density |
1.282g/cm3 |
Melting point |
206-210℃ |
Boiling point |
406.7°C at 760 mmHg |
Refractive index |
1.64 |
Flash point |
199.7°C |
Vapour Pressur |
3.4E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|