CAS No: 76784-95-7, Chemical Name: (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid
the physical and chemical property of 76784-95-7, (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid is provided by ChemNet.com
ChemNet > CAS > 76784-95-7 (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid
76784-95-7 (1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid
| product Name |
(1alpha,2alpha,4alpha)-1,2,4-Cyclohexanetricarboxylic acid |
| Synonyms |
1,2,4-Cyclohexanetricarboxylicacid, (1a,2a,4a)- |
| Molecular Formula |
C9H12O6 |
| Molecular Weight |
216.188 |
| InChI |
InChI=1/C9H12O6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15) |
| CAS Registry Number |
76784-95-7 |
| Molecular Structure |
|
| Density |
1.509g/cm3 |
| Boiling point |
470.1°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
252.2°C |
| Vapour Pressur |
3.9E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
