ChemNet > CAS > 78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
| product Name |
3-(4-chlorophenyl)-1H-pyrazol-5-amine |
| Synonyms |
5-(4-chlorophenyl)-1H-pyrazol-3-amine |
| Molecular Formula |
C9H8ClN3 |
| Molecular Weight |
193.6329 |
| InChI |
InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
| CAS Registry Number |
78583-81-0 |
| Molecular Structure |
|
| Density |
1.378g/cm3 |
| Melting point |
172℃ |
| Boiling point |
463.8°C at 760 mmHg |
| Refractive index |
1.67 |
| Flash point |
234.3°C |
| Vapour Pressur |
8.78E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
