ChemNet > CAS > 81029-03-0 2,3-Dimethyl-p-nitroanisole
81029-03-0 2,3-Dimethyl-p-nitroanisole
product Name |
2,3-Dimethyl-p-nitroanisole |
Synonyms |
2,3-Dimethyl-4-nitroanisole; 1-methoxy-2,3-dimethyl-4-nitrobenzene |
Molecular Formula |
C9H11NO3 |
Molecular Weight |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
CAS Registry Number |
81029-03-0 |
EINECS |
279-674-5 |
Molecular Structure |
|
Density |
1.148g/cm3 |
Melting point |
70-73℃ |
Boiling point |
303.2°C at 760 mmHg |
Refractive index |
1.534 |
Flash point |
141.2°C |
Vapour Pressur |
0.0017mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|