ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
| product Name |
2-Methoxybiphenyl |
| Synonyms |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Molecular Formula |
C13H12O |
| Molecular Weight |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS Registry Number |
86-26-0 |
| EINECS |
201-659-9 |
| Molecular Structure |
|
| Density |
1.03g/cm3 |
| Melting point |
30-33℃ |
| Boiling point |
274°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
101.3°C |
| Vapour Pressur |
0.00928mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R33:Danger of cummulative effects.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
