ChemNet > CAS > 86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
product Name |
ethyl 2,4-dichloro-6-methylnicotinate |
Synonyms |
ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
Molecular Formula |
C9H9Cl2NO2 |
Molecular Weight |
234.0793 |
InChI |
InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
CAS Registry Number |
86129-63-7 |
Molecular Structure |
|
Density |
1.32g/cm3 |
Melting point |
56℃ |
Boiling point |
298.2°C at 760 mmHg |
Refractive index |
1.537 |
Flash point |
134.1°C |
Vapour Pressur |
0.00129mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|