ChemNet > CAS > 91591-63-8 2,5-dichloro-4,6-dimethylnicotinonitrile
91591-63-8 2,5-dichloro-4,6-dimethylnicotinonitrile
| product Name |
2,5-dichloro-4,6-dimethylnicotinonitrile |
| Synonyms |
2,5-dichloro-4,6-dimethylpyridine-3-carbonitrile |
| Molecular Formula |
C8H6Cl2N2 |
| Molecular Weight |
201.0526 |
| InChI |
InChI=1/C8H6Cl2N2/c1-4-6(3-11)8(10)12-5(2)7(4)9/h1-2H3 |
| CAS Registry Number |
91591-63-8 |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Melting point |
78℃ |
| Boiling point |
304.6°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
138°C |
| Vapour Pressur |
0.000867mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
