CAS No: 95111-49-2, Chemical Name: 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one
the physical and chemical property of 95111-49-2, 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one is provided by ChemNet.com
ChemNet > CAS > 95111-49-2 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one
95111-49-2 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one
| product Name |
2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one |
| Synonyms |
2,5-cyclohexadien-1-one, 2,3,5,6-tetrabromo-4-methyl-4-nitro-; 2,3,5,6-tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dienone |
| Molecular Formula |
C7H3Br4NO3 |
| Molecular Weight |
468.7196 |
| InChI |
InChI=1/C7H3Br4NO3/c1-7(12(14)15)5(10)2(8)4(13)3(9)6(7)11/h1H3 |
| CAS Registry Number |
95111-49-2 |
| Molecular Structure |
|
| Density |
2.66g/cm3 |
| Boiling point |
466.3°C at 760 mmHg |
| Refractive index |
1.706 |
| Flash point |
235.8°C |
| Vapour Pressur |
7.17E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
