ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
| product Name |
Diallyl maleate |
| Synonyms |
Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
| Molecular Formula |
C10H12O4 |
| Molecular Weight |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
| CAS Registry Number |
999-21-3 |
| EINECS |
213-658-0 |
| Molecular Structure |
|
| Density |
1.064g/cm3 |
| Boiling point |
263.7°C at 760 mmHg |
| Refractive index |
1.469 |
| Flash point |
124.6°C |
| Vapour Pressur |
0.0101mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
