ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
| Nom |
Ethyl hydrogen glutarate |
| Synonymes |
Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate |
| Formule moléculaire |
C7H12O4 |
| Poids Moléculaire |
160.1678 |
| InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| Numéro de registre CAS |
1070-62-8 |
| EINECS |
213-977-5 |
| Structure moléculaire |
|
| Densité |
1.126g/cm3 |
| Point d'ébullition |
280°C at 760 mmHg |
| Indice de réfraction |
1.444 |
| Point d'éclair |
112.5°C |
| Les symboles de danger |
|
| Codes des risques |
R36/38:Irritating to eyes and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
