ChemNet > CAS > 102170-56-9 2-Bromo-6-methyl-4-nitroaniline
102170-56-9 2-Bromo-6-methyl-4-nitroaniline
| Ονομασία του προϊόντος |
2-Bromo-6-methyl-4-nitroaniline |
| MF |
C7H7BrN2O2 |
| Μοριακό βάρος |
231.0467 |
| InChI |
InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
| CAS ΟΧΙ |
102170-56-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.698g/cm3 |
| Σημείο τήξης |
177-181℃ |
| Σημείο βρασμού |
366°C at 760 mmHg |
| Δείκτης διάθλασης |
1.648 |
| Σημείο ανάφλεξης |
175.2°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
