ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
| Ονομασία του προϊόντος |
3-Hydroxyphenylacetylene |
| Συνώνυμα |
3-Ethynylphenol |
| MF |
C8H6O |
| Μοριακό βάρος |
118.1326 |
| InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS ΟΧΙ |
10401-11-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.12g/cm3 |
| Σημείο βρασμού |
230.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.589 |
| Σημείο ανάφλεξης |
106.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
