ChemNet > CAS > 10546-64-2 2,6-Dibromo-4-n-propylaniline
10546-64-2 2,6-Dibromo-4-n-propylaniline
Ονομασία του προϊόντος |
2,6-Dibromo-4-n-propylaniline |
Συνώνυμα |
2,6-dibromo-4-propylaniline |
MF |
C9H11Br2N |
Μοριακό βάρος |
292.9983 |
InChI |
InChI=1/C9H11Br2N/c1-2-3-6-4-7(10)9(12)8(11)5-6/h4-5H,2-3,12H2,1H3 |
CAS ΟΧΙ |
10546-64-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.689g/cm3 |
Σημείο βρασμού |
316.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.609 |
Σημείο ανάφλεξης |
145.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|