ChemNet > CAS > 1122-60-7 nitrocyclohexane
1122-60-7 nitrocyclohexane
| Ονομασία του προϊόντος |
nitrocyclohexane |
| Συνώνυμα |
Hexahydronitrobenzene |
| MF |
C6H11NO2 |
| Μοριακό βάρος |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| CAS ΟΧΙ |
1122-60-7 |
| EINECS |
214-354-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.05g/cm3 |
| Σημείο βρασμού |
202.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.465 |
| Σημείο ανάφλεξης |
81.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
