ChemNet > CAS > 1122-97-0 4-(Methylthio)thiophenol
1122-97-0 4-(Methylthio)thiophenol
| Ονομασία του προϊόντος |
4-(Methylthio)thiophenol |
| Συνώνυμα |
4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol |
| MF |
C7H8S2 |
| Μοριακό βάρος |
156.2684 |
| InChI |
InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| CAS ΟΧΙ |
1122-97-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.16g/cm3 |
| Σημείο βρασμού |
252.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.621 |
| Σημείο ανάφλεξης |
106.7°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
