ChemNet > CAS > 1124-39-6 4-Ethylcatechol
1124-39-6 4-Ethylcatechol
Ονομασία του προϊόντος |
4-Ethylcatechol |
Συνώνυμα |
3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
MF |
C8H10O2 |
Μοριακό βάρος |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
CAS ΟΧΙ |
1124-39-6 |
EINECS |
214-397-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.159g/cm3 |
Σημείο βρασμού |
273.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.578 |
Σημείο ανάφλεξης |
134.1°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|