ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
Ονομασία του προϊόντος |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
MF |
C7H11FO2 |
Μοριακό βάρος |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
CAS ΟΧΙ |
1171-47-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.159g/cm3 |
Σημείο βρασμού |
227.566°C at 760 mmHg |
Δείκτης διάθλασης |
1.454 |
Σημείο ανάφλεξης |
91.429°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|