ChemNet > CAS > 1198-37-4 2,4-dimethylquinoline
1198-37-4 2,4-dimethylquinoline
Ονομασία του προϊόντος |
2,4-dimethylquinoline |
Συνώνυμα |
Dimethylquinoline |
MF |
C11H11N |
Μοριακό βάρος |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
CAS ΟΧΙ |
1198-37-4 |
EINECS |
214-832-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.052g/cm3 |
Σημείο βρασμού |
263.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.61 |
Σημείο ανάφλεξης |
107.6°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|