ChemNet > CAS > 1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile
1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile
Ονομασία του προϊόντος |
1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
Συνώνυμα |
1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
MF |
C13H15NO |
Μοριακό βάρος |
201.2643 |
InChI |
InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS ΟΧΙ |
1206-15-1 |
EINECS |
214-890-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.07g/cm3 |
Σημείο βρασμού |
346.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.543 |
Σημείο ανάφλεξης |
146.2°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|