ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
| Ονομασία του προϊόντος |
Difluoromandelicacid |
| Συνώνυμα |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| MF |
C8H6F2O3 |
| Μοριακό βάρος |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| CAS ΟΧΙ |
132741-29-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.522g/cm3 |
| Σημείο τήξης |
92-94℃ |
| Σημείο βρασμού |
320.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.542 |
| Σημείο ανάφλεξης |
147.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
