ChemNet > CAS > 132898-95-4 2,2'-bithiophene-5-boronic acid
132898-95-4 2,2'-bithiophene-5-boronic acid
| Ονομασία του προϊόντος |
2,2'-bithiophene-5-boronic acid |
| Συνώνυμα |
2,2'-bithiophen-5-ylboronic acid |
| MF |
C8H7BO2S2 |
| Μοριακό βάρος |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| CAS ΟΧΙ |
132898-95-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.42g/cm3 |
| Σημείο τήξης |
127℃ |
| Σημείο βρασμού |
416.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.658 |
| Σημείο ανάφλεξης |
205.5°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
