ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
| Ονομασία του προϊόντος |
3,5-Dimethoxyphenylacetonitrile |
| MF |
C10H11NO2 |
| Μοριακό βάρος |
177.1998 |
| InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
| CAS ΟΧΙ |
13388-75-5 |
| EINECS |
202-225-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.082g/cm3 |
| Σημείο βρασμού |
316.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.511 |
| Σημείο ανάφλεξης |
127.3°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
