ChemNet > CAS > 137-97-3 1,3-di-O-tolyl-2-thiourea
137-97-3 1,3-di-O-tolyl-2-thiourea
Ονομασία του προϊόντος |
1,3-di-O-tolyl-2-thiourea |
Συνώνυμα |
Ditolylthiourea; N,N-Di-o-tolylthiourea; N,N-Bis(2-Methylphenyl)thiourea; N,N,N-trimethyl(phenyl)methanaminium bromide; 1,3-bis(2-methylphenyl)thiourea |
MF |
C15H16N2S |
Μοριακό βάρος |
256.3659 |
InChI |
InChI=1/C15H16N2S/c1-11-7-3-5-9-13(11)16-15(18)17-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H2,16,17,18) |
CAS ΟΧΙ |
137-97-3 |
EINECS |
205-309-6 |
Μοριακή δομή |
|
Πυκνότητα |
1.219g/cm3 |
Σημείο τήξης |
157-159℃ |
Σημείο βρασμού |
367.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.707 |
Σημείο ανάφλεξης |
176°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|