ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
| Ονομασία του προϊόντος |
3,5-Dibromo-4-methylphenol |
| Συνώνυμα |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| MF |
C7H6Br2O |
| Μοριακό βάρος |
265.9299 |
| InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| CAS ΟΧΙ |
13979-81-2 |
| EINECS |
237-763-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.948g/cm3 |
| Σημείο βρασμού |
293.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.626 |
| Σημείο ανάφλεξης |
131.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
