ChemNet > CAS > 14109-72-9 1-Methylthio-2-propanone
14109-72-9 1-Methylthio-2-propanone
Ονομασία του προϊόντος |
1-Methylthio-2-propanone |
Συνώνυμα |
1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
MF |
C4H8OS |
Μοριακό βάρος |
104.1707 |
InChI |
InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
CAS ΟΧΙ |
14109-72-9 |
Μοριακή δομή |
|
Πυκνότητα |
0.985g/cm3 |
Σημείο βρασμού |
144°C at 760 mmHg |
Δείκτης διάθλασης |
1.453 |
Σημείο ανάφλεξης |
42.8°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R10:Flammable.;
|
Περιγραφή της ασφάλειας |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|