ChemNet > CAS > 1443-76-1 3,5-Dimethoxy-4-hydroxybenzhydrazide
1443-76-1 3,5-Dimethoxy-4-hydroxybenzhydrazide
| Ονομασία του προϊόντος |
3,5-Dimethoxy-4-hydroxybenzhydrazide |
| Συνώνυμα |
4-Hydroxy-3,5-dimethoxybenzohydrazide; Benzoic acid, 4-hydroxy-3,5-dimethoxy-, hydrazide |
| MF |
C9H12N2O4 |
| Μοριακό βάρος |
212.2026 |
| InChI |
InChI=1/C9H12N2O4/c1-14-6-3-5(9(13)11-10)4-7(15-2)8(6)12/h3-4,12H,10H2,1-2H3,(H,11,13) |
| CAS ΟΧΙ |
1443-76-1 |
| EINECS |
215-884-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.298g/cm3 |
| Δείκτης διάθλασης |
1.575 |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
