ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
| Ονομασία του προϊόντος |
1,15-Pentadecanedioic acid |
| Συνώνυμα |
Pentadecanedioic acid |
| MF |
C15H28O4 |
| Μοριακό βάρος |
272.3804 |
| InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
| CAS ΟΧΙ |
1460-18-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.026g/cm3 |
| Σημείο τήξης |
113-114℃ |
| Σημείο βρασμού |
445.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.474 |
| Σημείο ανάφλεξης |
237.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
